898754-84-2 Usage
Uses
Used in Pharmaceutical Industry:
2',4'-DIMETHYL-3-(2,6-DIMETHYLPHENYL)PROPIOPHENONE is used as a key intermediate in the synthesis of various pharmaceuticals for its versatile reactivity and potential biological activities. Its unique chemical structure allows for the development of new drugs with improved efficacy and safety profiles.
Used in Organic Chemistry:
In the field of organic chemistry, 2',4'-DIMETHYL-3-(2,6-DIMETHYLPHENYL)PROPIOPHENONE serves as a valuable building block for the synthesis of a wide range of organic compounds. Its reactivity and functional groups enable the formation of various chemical bonds and reactions, facilitating the creation of novel molecules with diverse applications.
Used in Fragrance Industry:
2',4'-DIMETHYL-3-(2,6-DIMETHYLPHENYL)PROPIOPHENONE is used as a raw material in the production of fragrances due to its unique scent profile. Its incorporation into fragrance formulations can enhance the overall aroma and provide a distinct olfactory experience.
Used in Dye Industry:
In the dye industry, 2',4'-DIMETHYL-3-(2,6-DIMETHYLPHENYL)PROPIOPHENONE is utilized as a precursor for the synthesis of various dyes. Its chemical structure allows for the development of dyes with specific color properties and improved stability, catering to the needs of different applications.
Used in Fine Chemicals Industry:
2',4'-DIMETHYL-3-(2,6-DIMETHYLPHENYL)PROPIOPHENONE is employed as a building block in the production of fine chemicals, such as specialty chemicals and intermediates for various applications. Its unique properties and reactivity contribute to the development of high-quality and high-performance products.
Potential Applications in Medicine, Biochemistry, and Materials Science:
Due to its unique chemical structure and properties, 2',4'-DIMETHYL-3-(2,6-DIMETHYLPHENYL)PROPIOPHENONE may have potential applications in the fields of medicine, biochemistry, and materials science. Its versatility and reactivity can be harnessed for the development of new therapeutic agents, diagnostic tools, and advanced materials with improved performance and functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 898754-84-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,5 and 4 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 898754-84:
(8*8)+(7*9)+(6*8)+(5*7)+(4*5)+(3*4)+(2*8)+(1*4)=262
262 % 10 = 2
So 898754-84-2 is a valid CAS Registry Number.
InChI:InChI=1/C19H22O/c1-13-8-9-18(16(4)12-13)19(20)11-10-17-14(2)6-5-7-15(17)3/h5-9,12H,10-11H2,1-4H3
