898754-91-1 Usage
Chemical compound
2'-AZETIDINOMETHYL-2,6-DIMETHYLBENZOPHENONE
Properties
1. Used as a photoinitiator in industrial applications
2. Initiates polymerization reactions when exposed to UV light
3. Contains a benzophenone group and an azetidine ring
4. Efficiently absorbs UV light
5. Enables curing of UV-activated polymer materials
Specific content
1. Used in manufacturing coatings, inks, and adhesives
2. Generates free radicals to initiate polymerization process
3. Requires proper handling and storage for safety
4. Should follow protocols to minimize potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 898754-91-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,5 and 4 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 898754-91:
(8*8)+(7*9)+(6*8)+(5*7)+(4*5)+(3*4)+(2*9)+(1*1)=261
261 % 10 = 1
So 898754-91-1 is a valid CAS Registry Number.
InChI:InChI=1/C19H21NO/c1-14-7-5-8-15(2)18(14)19(21)17-10-4-3-9-16(17)13-20-11-6-12-20/h3-5,7-10H,6,11-13H2,1-2H3
