898756-88-2 Usage
Uses
Used in Pharmaceutical Industry:
2',4'-Dichloro-4-(5,5-dimethyl-1,3-dioxan-2-yl)butyrophenone is used as a pharmaceutical intermediate for the synthesis of various drugs and medications. Its chemical structure and properties make it a valuable component in the development of new pharmaceutical products.
Used in Drug Synthesis:
2',4'-Dichloro-4-(5,5-dimethyl-1,3-dioxan-2-yl)butyrophenone is used as a key building block in the synthesis of different types of medications. Its presence in the molecular structure of these drugs contributes to their therapeutic effects and helps in achieving the desired pharmacological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 898756-88-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,5 and 6 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 898756-88:
(8*8)+(7*9)+(6*8)+(5*7)+(4*5)+(3*6)+(2*8)+(1*8)=272
272 % 10 = 2
So 898756-88-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H20Cl2O3/c1-16(2)9-20-15(21-10-16)5-3-4-14(19)12-7-6-11(17)8-13(12)18/h6-8,15H,3-5,9-10H2,1-2H3
