898759-16-5 Usage
Heterocyclic compound
Contains both oxygen and nitrogen atoms in a five-membered ring structure
Usage
Commonly used in the synthesis of pharmaceuticals and other organic compounds
Potential applications
Organic chemistry, specifically in the development of new reactions and methodologies
Natural occurrence
Present in certain plant species, may play a role in plant defense mechanisms or interactions with other organisms in the environment
Check Digit Verification of cas no
The CAS Registry Mumber 898759-16-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,5 and 9 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 898759-16:
(8*8)+(7*9)+(6*8)+(5*7)+(4*5)+(3*9)+(2*1)+(1*6)=265
265 % 10 = 5
So 898759-16-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO2/c1-6(2)5-7(10)8-9-3-4-11-8/h3-4,6H,5H2,1-2H3
