898759-26-7 Usage
Uses
Used in Pharmaceutical Industry:
2-(3-Methylvaleryl)oxazole is utilized as a building block in organic synthesis for the development of new pharmaceutical compounds. Its potential biological activities, including antibacterial, antifungal, and anti-inflammatory properties, make it a valuable component in the creation of drugs targeting various health conditions.
Used in Flavor and Fragrance Industry:
In the flavor and fragrance industry, 2-(3-Methylvaleryl)oxazole is employed as a scent additive. Its unique olfactory properties contribute to the development of various fragrances and flavorings, enhancing the sensory experience of consumer products.
Overall, 2-(3-Methylvaleryl)oxazole is a multifaceted chemical compound with applications spanning across the pharmaceutical, flavor, and fragrance industries, highlighting its significance in both medicinal and sensory domains.
Check Digit Verification of cas no
The CAS Registry Mumber 898759-26-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,5 and 9 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 898759-26:
(8*8)+(7*9)+(6*8)+(5*7)+(4*5)+(3*9)+(2*2)+(1*6)=267
267 % 10 = 7
So 898759-26-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H13NO2/c1-3-7(2)6-8(11)9-10-4-5-12-9/h4-5,7H,3,6H2,1-2H3
