898759-69-8 Usage
Uses
Used in Organic Chemistry:
2-(3-Fluorobenzoyl)oxazole is used as a building block for the synthesis of various pharmaceuticals, agrochemicals, and materials. Its presence in these compounds can contribute to their chemical properties and potential therapeutic effects.
Used in Pharmaceutical Industry:
2-(3-Fluorobenzoyl)oxazole is used as an intermediate in the production of diverse compounds with potential applications in the pharmaceutical industry. Its unique structure allows for the development of new drugs with improved efficacy and reduced side effects.
Used in Agrochemical Industry:
2-(3-Fluorobenzoyl)oxazole is used as a component in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these products can enhance their effectiveness in controlling pests and weeds while minimizing environmental impact.
Used in Material Science:
2-(3-Fluorobenzoyl)oxazole is used in the development of new materials with specific properties, such as improved strength, flexibility, or thermal stability. Its presence in these materials can contribute to their performance and applicability in various fields.
Used in Fluorescent Dyes:
2-(3-Fluorobenzoyl)oxazole is used in the development of fluorescent dyes and other functional molecules. Its fluorobenzoyl group can impart unique optical properties to these dyes, making them useful in applications such as bioimaging, sensing, and diagnostics.
Used in Research and Development:
2-(3-Fluorobenzoyl)oxazole is used as a valuable intermediate in the production of diverse compounds for research and development purposes. Its versatility in chemical reactions allows for the exploration of new compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 898759-69-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,5 and 9 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 898759-69:
(8*8)+(7*9)+(6*8)+(5*7)+(4*5)+(3*9)+(2*6)+(1*9)=278
278 % 10 = 8
So 898759-69-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H6FNO2/c11-8-3-1-2-7(6-8)9(13)10-12-4-5-14-10/h1-6H
