898767-67-4 Usage
Uses
Used in Pharmaceutical Industry:
2',4'-DIFLUORO-3-(3-FLUOROPHENYL)PROPIOPHENONE is used as a potential pharmaceutical compound for its unique structure and pharmacological properties. Its specific applications may include the development of new drugs targeting various diseases, given its potential to interact with biological systems in novel ways.
Used in Agrochemical Industry:
In the agrochemical field, 2',4'-DIFLUORO-3-(3-FLUOROPHENYL)PROPIOPHENONE may be utilized as an intermediate in the synthesis of new agrochemicals, such as pesticides or herbicides. Its unique structure could contribute to the development of more effective and environmentally friendly products.
Used in Chemical Synthesis:
2',4'-DIFLUORO-3-(3-FLUOROPHENYL)PROPIOPHENONE can also be used as a key intermediate in the synthesis of other complex organic compounds. Its presence of fluorine atoms and the 3-fluorophenyl group may facilitate the formation of new chemical entities with diverse applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 898767-67-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,6 and 7 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 898767-67:
(8*8)+(7*9)+(6*8)+(5*7)+(4*6)+(3*7)+(2*6)+(1*7)=274
274 % 10 = 4
So 898767-67-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H11F3O/c16-11-3-1-2-10(8-11)4-7-15(19)13-6-5-12(17)9-14(13)18/h1-3,5-6,8-9H,4,7H2
