898768-34-8 Usage
Uses
Used in Pharmaceutical Industry:
2',6'-DIMETHYL-3-(4-FLUOROPHENYL)PROPIOPHENONE is used as an intermediate compound for the synthesis of various pharmaceutical drugs. Its unique structure allows for the creation of new drug molecules with potential therapeutic applications.
Used in Research Applications:
In the field of organic chemistry, 2',6'-DIMETHYL-3-(4-FLUOROPHENYL)PROPIOPHENONE is used as a research compound to study its chemical properties and potential interactions with other molecules. This can lead to a better understanding of its pharmacological effects and possible uses in drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 898768-34-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,6 and 8 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 898768-34:
(8*8)+(7*9)+(6*8)+(5*7)+(4*6)+(3*8)+(2*3)+(1*4)=268
268 % 10 = 8
So 898768-34-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H17FO/c1-12-4-3-5-13(2)17(12)16(19)11-8-14-6-9-15(18)10-7-14/h3-7,9-10H,8,11H2,1-2H3