898769-46-5 Usage
Properties
1. Name: 2',6'-dichloro-3-(4-methylphenyl)propiophenone
2. Common Name: Diclazepam
3. Drug Class: Benzodiazepine
4. Function: Anxiolytic sedative and muscle relaxant
5. Effects: Sedation, relaxation, reduced anxiety
6. CNS Depressant: Powerful central nervous system depressant
7. Abuse Potential: Known for potential abuse and dependence
8. Medical Approval: Not approved for medical use in many countries
9. Illicit Market: Commonly found on the illicit drug market
10. Risk: Poses a risk for addiction and overdose
11. Side Effects: Drowsiness, dizziness, impairment of coordination, memory problems
Check Digit Verification of cas no
The CAS Registry Mumber 898769-46-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,6 and 9 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 898769-46:
(8*8)+(7*9)+(6*8)+(5*7)+(4*6)+(3*9)+(2*4)+(1*6)=275
275 % 10 = 5
So 898769-46-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H14Cl2O/c1-11-5-7-12(8-6-11)9-10-15(19)16-13(17)3-2-4-14(16)18/h2-8H,9-10H2,1H3
