898769-99-8 Usage
Uses
Used in Pharmaceutical Industry:
2',4'-DIMETHYL-3-(2-METHOXYPHENYL)PROPIOPHENONE is used as a key intermediate in the synthesis of various pharmaceuticals for its potential therapeutic applications. Its unique chemical structure allows for the development of new drugs with improved efficacy and safety profiles.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, 2',4'-DIMETHYL-3-(2-METHOXYPHENYL)PROPIOPHENONE serves as an important building block for the synthesis of a wide range of organic compounds. Its versatile structure enables the creation of novel molecules with diverse applications in various industries.
Used in Chemical Research and Development:
2',4'-DIMETHYL-3-(2-METHOXYPHENYL)PROPIOPHENONE is employed in chemical research and development processes to explore its potential pharmacological properties and investigate its role in the synthesis of new compounds. This research contributes to the advancement of scientific knowledge and the discovery of innovative applications for 2',4'-DIMETHYL-3-(2-METHOXYPHENYL)PROPIOPHENONE.
Check Digit Verification of cas no
The CAS Registry Mumber 898769-99-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,6 and 9 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 898769-99:
(8*8)+(7*9)+(6*8)+(5*7)+(4*6)+(3*9)+(2*9)+(1*9)=288
288 % 10 = 8
So 898769-99-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H20O2/c1-13-8-10-16(14(2)12-13)17(19)11-9-15-6-4-5-7-18(15)20-3/h4-8,10,12H,9,11H2,1-3H3
