898770-08-6 Usage
Chemical compound
2,5-DIMETHYL-4'-MORPHOLINOMETHYL BENZOPHENONE is a chemical compound, which means it is a substance composed of two or more elements chemically bonded together.
Photoinitiator
It is commonly used as a photoinitiator in the production of various products, meaning it helps start the process of polymerization when exposed to light, particularly ultraviolet (UV) radiation.
Applications
The compound is used in the production of adhesives, coatings, and inks, indicating its versatility in different industries.
Benzophenone derivative
It is derived from benzophenone, which is an organic compound containing a ketone group and a benzene ring, providing the basic structure for this photoinitiator.
Morpholinomethyl group
The presence of a substituent morpholinomethyl group makes it especially effective in initiating photopolymerization reactions, enhancing its performance as a photoinitiator.
Absorption of UV radiation
2,5-DIMETHYL-4'-MORPHOLINOMETHYL BENZOPHENONE can absorb UV radiation, which is crucial for its function as a photoinitiator.
Energy transfer
The compound transfers the absorbed energy to other molecules, which initiates the formation of polymers through a process called photopolymerization.
Low volatility
It has low volatility, meaning it does not easily vaporize or evaporate at room temperature, making it safer and more stable for use in various industrial applications.
Low odor
The compound has a low odor, contributing to a more pleasant working environment and reducing the need for ventilation when handling the substance.
UV-curing processes
2,5-DIMETHYL-4'-MORPHOLINOMETHYL BENZOPHENONE is particularly suitable for industrial applications that require UV-curing processes, such as the production of adhesives, coatings, and inks.
Check Digit Verification of cas no
The CAS Registry Mumber 898770-08-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,7 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 898770-08:
(8*8)+(7*9)+(6*8)+(5*7)+(4*7)+(3*0)+(2*0)+(1*8)=246
246 % 10 = 6
So 898770-08-6 is a valid CAS Registry Number.
InChI:InChI=1/C20H23NO2/c1-15-3-4-16(2)19(13-15)20(22)18-7-5-17(6-8-18)14-21-9-11-23-12-10-21/h3-8,13H,9-12,14H2,1-2H3