898770-59-7 Usage
Main properties
1. Chemical compound
2. UV-absorber
3. Protective properties against UV radiation
4. Utilized in sunscreens, cosmetics, inks, adhesives, and plastics
Specific content
1. Name: 2,5-DICHLORO-4'-MORPHOLINOMETHYL BENZOPHENONE
2. Usage: Production of sunscreens and other cosmetics
3. Function: Absorbs and converts UV radiation into harmless heat
4. Industrial applications: Inks, adhesives, and plastics
5. Impacts: Ongoing research and debate regarding potential health and environmental impacts
6. Safety: Manufacturers and users should exercise caution and adhere to safety guidelines when handling and using this chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 898770-59-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,7 and 0 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 898770-59:
(8*8)+(7*9)+(6*8)+(5*7)+(4*7)+(3*0)+(2*5)+(1*9)=257
257 % 10 = 7
So 898770-59-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H17Cl2NO2/c19-15-5-6-17(20)16(11-15)18(22)14-3-1-13(2-4-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2