898770-73-5 Usage
Description
CYCLOPROPYL 4-(MORPHOLINOMETHYL)PHENYL KETONE is a chemical compound that belongs to the group of ketones. It is composed of a cyclopropyl group, a morpholinomethyl group, and a phenyl ketone group. This unique structure and properties make it a valuable building block in the synthesis of complex molecules with potential biological activities.
Uses
Used in Pharmaceutical Research:
CYCLOPROPYL 4-(MORPHOLINOMETHYL)PHENYL KETONE is used as a key intermediate in the development of new drugs and pharmaceuticals due to its potential pharmacological properties.
Used in Organic Synthesis:
CYCLOPROPYL 4-(MORPHOLINOMETHYL)PHENYL KETONE is used as a building block in the synthesis of complex organic compounds with potential applications in various industries.
Used in Production of Organic Compounds:
CYCLOPROPYL 4-(MORPHOLINOMETHYL)PHENYL KETONE is used as a precursor in the production of various organic compounds, contributing to the advancement of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 898770-73-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,7 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 898770-73:
(8*8)+(7*9)+(6*8)+(5*7)+(4*7)+(3*0)+(2*7)+(1*3)=255
255 % 10 = 5
So 898770-73-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H19NO2/c17-15(14-5-6-14)13-3-1-12(2-4-13)11-16-7-9-18-10-8-16/h1-4,14H,5-11H2