898775-19-4 Usage
Main properties
1. Chemical Formula: C15H12Cl2O2
2. Derivative of propiophenone
3. Contains two chlorine atoms and a methoxy group
4. Potential applications in pharmaceuticals, agrochemicals, and materials science
Specific content
1. Molecular formula: C15H12Cl2O2
2. Derivative of: propiophenone
3. Functional groups: two chlorine atoms and a methoxy group
4. Applications: pharmaceuticals, agrochemicals, materials science
5. Potential uses: starting material in synthesis of organic compounds, building block in drug development
6. Potential biological activities: antioxidant, antimicrobial
Check Digit Verification of cas no
The CAS Registry Mumber 898775-19-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,7 and 5 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 898775-19:
(8*8)+(7*9)+(6*8)+(5*7)+(4*7)+(3*5)+(2*1)+(1*9)=264
264 % 10 = 4
So 898775-19-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H14Cl2O2/c1-20-13-4-2-3-11(9-13)5-8-16(19)14-10-12(17)6-7-15(14)18/h2-4,6-7,9-10H,5,8H2,1H3
