898776-37-9 Usage
Uses
Used in Pharmaceutical Industry:
2',4'-DIFLUORO-3-(4-METHOXYPHENYL)PROPIOPHENONE is used as a building block for the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with improved therapeutic properties and reduced side effects.
Used in Agrochemical Industry:
2',4'-DIFLUORO-3-(4-METHOXYPHENYL)PROPIOPHENONE is also utilized as a key intermediate in the synthesis of agrochemicals, contributing to the development of more effective and environmentally friendly pesticides and herbicides.
Used in Chemical Research and Development:
2',4'-DIFLUORO-3-(4-METHOXYPHENYL)PROPIOPHENONE serves as an important tool in chemical research and development. Its unique structural features make it a valuable compound for studying various chemical reactions and exploring new synthetic pathways.
Used in Organic Synthesis:
As a propiophenone derivative, 2',4'-DIFLUORO-3-(4-METHOXYPHENYL)PROPIOPHENONE is used in organic synthesis for the preparation of various organic compounds. Its presence of fluorine atoms and a 4-methoxyphenyl group at specific positions enhances its reactivity and selectivity in chemical reactions.
Used in Pharmacological Research:
2',4'-DIFLUORO-3-(4-METHOXYPHENYL)PROPIOPHENONE has been studied for its potential pharmacological properties, including anti-inflammatory and analgesic effects. Its unique structure allows researchers to investigate its interactions with biological targets and explore its potential as a therapeutic agent for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 898776-37-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,7 and 6 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 898776-37:
(8*8)+(7*9)+(6*8)+(5*7)+(4*7)+(3*6)+(2*3)+(1*7)=269
269 % 10 = 9
So 898776-37-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H14F2O2/c1-20-13-6-2-11(3-7-13)4-9-16(19)14-8-5-12(17)10-15(14)18/h2-3,5-8,10H,4,9H2,1H3
