898777-52-1 Usage
General Description
2',6'-DICHLORO-3-(3,4-DIFLUOROPHENYL)PROPIOPHENONE is a chemical compound with a complex molecular structure. It consists of two chlorine atoms at positions 2 and 6, and a 3,4-difluorophenyl group attached to a propiophenone backbone. This chemical may have potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science. Its precise properties and uses are likely to depend on the specific characteristics of its molecular structure and how it interacts with other substances. Further research and testing would be necessary to fully understand and harness the potential of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 898777-52-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,7 and 7 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 898777-52:
(8*8)+(7*9)+(6*8)+(5*7)+(4*7)+(3*7)+(2*5)+(1*2)=271
271 % 10 = 1
So 898777-52-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H10Cl2F2O/c16-10-2-1-3-11(17)15(10)14(20)7-5-9-4-6-12(18)13(19)8-9/h1-4,6,8H,5,7H2
