898779-10-7 Usage
Molecular structure
A thiophene ring with a 3,4-dimethoxybenzoyl group and a 1,3-dioxolan-2-yl group attached to it.
Thiophene ring
A five-membered ring with four carbon atoms and one sulfur atom, commonly found in organic compounds.
Functional groups
The presence of the dimethoxybenzoyl group and the dioxolan-2-yl group adds functional groups to the thiophene ring.
Reactivity
The functional groups can affect the reactivity of the compound.
Chemical properties
The chemical properties of the compound are influenced by the attached functional groups.
Potential applications
2-(3,4-dimethoxybenzoyl)-5-(1,3-dioxolan-2-yl)thiophene could potentially be used in pharmaceuticals, materials science, or organic synthesis.
Further investigation
The specific properties and potential applications of the compound would depend on further investigation and research.
Check Digit Verification of cas no
The CAS Registry Mumber 898779-10-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,7 and 9 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 898779-10:
(8*8)+(7*9)+(6*8)+(5*7)+(4*7)+(3*9)+(2*1)+(1*0)=267
267 % 10 = 7
So 898779-10-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H16O5S/c1-18-11-4-3-10(9-12(11)19-2)15(17)13-5-6-14(22-13)16-20-7-8-21-16/h3-6,9,16H,7-8H2,1-2H3
