898779-40-3 Usage
Uses
Used in Food Industry:
2-Decanoylpyridine is utilized as a flavoring agent, imparting rich and distinct flavors to products such as cheese, butter, and baked goods. Its ability to enhance taste profiles makes it a valuable addition to the culinary world.
Used in Fragrance Industry:
In the realm of fragrances, 2-decanoylpyridine serves as a key component in the creation of various scent profiles. Its unique olfactory properties contribute to the development of complex and appealing fragrances.
Used in Pharmaceutical Industry:
As an intermediate in the synthesis of pharmaceuticals, 2-decanoylpyridine plays a crucial role in the development of new drugs. Its chemical structure allows for its incorporation into a wide range of medicinal compounds.
Used in Antimicrobial and Antifungal Applications:
2-Decanoylpyridine has been studied for its potential antimicrobial and antifungal properties, indicating its use in applications that require the inhibition of microbial growth. This makes it a versatile compound for various industrial applications, particularly in areas where controlling microbial contamination is essential.
Check Digit Verification of cas no
The CAS Registry Mumber 898779-40-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,7 and 9 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 898779-40:
(8*8)+(7*9)+(6*8)+(5*7)+(4*7)+(3*9)+(2*4)+(1*0)=273
273 % 10 = 3
So 898779-40-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H23NO/c1-2-3-4-5-6-7-8-12-15(17)14-11-9-10-13-16-14/h9-11,13H,2-8,12H2,1H3
