898779-85-6 Usage
Uses
Used in Pharmaceutical Industry:
2',4'-DIFLUORO-3-(3,4-DIMETHYLPHENYL)PROPIOPHENONE is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs. Its unique structure allows for the creation of molecules with specific therapeutic properties, making it valuable in medicinal chemistry.
Used in Chemical Industry:
In the chemical industry, 2',4'-DIFLUORO-3-(3,4-DIMETHYLPHENYL)PROPIOPHENONE serves as a crucial building block for the synthesis of a range of organic compounds. Its fluorinated and substituted phenyl structure provides a versatile platform for further chemical reactions, facilitating the production of specialty chemicals and materials with tailored properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 898779-85-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,7 and 9 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 898779-85:
(8*8)+(7*9)+(6*8)+(5*7)+(4*7)+(3*9)+(2*8)+(1*5)=286
286 % 10 = 6
So 898779-85-6 is a valid CAS Registry Number.
InChI:InChI=1/C17H16F2O/c1-11-3-4-13(9-12(11)2)5-8-17(20)15-7-6-14(18)10-16(15)19/h3-4,6-7,9-10H,5,8H2,1-2H3
