898780-46-6 Usage
Uses
Used in Pharmaceutical Industry:
2',4'-Dichloro-3-(2-thiomethylphenyl)propiophenone is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs and medicinal compounds. Its unique chemical structure allows for the creation of a wide range of therapeutic agents, enhancing the industry's capacity to address various health conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 2',4'-Dichloro-3-(2-thiomethylphenyl)propiophenone is utilized as an intermediate in the production of agrochemicals, such as pesticides and herbicides. Its involvement in the synthesis process aids in the development of effective solutions to protect crops and enhance agricultural productivity.
Used in Organic Compounds Synthesis:
2',4'-Dichloro-3-(2-thiomethylphenyl)propiophenone is employed as an intermediate in the synthesis of various organic compounds, showcasing its versatility in the field of organic chemistry. Its unique properties enable the creation of a broad spectrum of chemical entities, contributing to the advancement of scientific research and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 898780-46-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,8 and 0 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 898780-46:
(8*8)+(7*9)+(6*8)+(5*7)+(4*8)+(3*0)+(2*4)+(1*6)=256
256 % 10 = 6
So 898780-46-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H14Cl2OS/c1-20-16-5-3-2-4-11(16)6-9-15(19)13-8-7-12(17)10-14(13)18/h2-5,7-8,10H,6,9H2,1H3
