898780-57-9 Usage
Uses
Used in Organic Synthesis:
2',4'-DIFLUORO-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE is used as a building block in organic synthesis for the preparation of various pharmaceutical drugs and organic compounds. Its unique structure and reactivity contribute to the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2',4'-DIFLUORO-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE serves as a key intermediate in the development of new drugs. Its unique properties allow for the creation of novel therapeutic agents with potential applications in various medical fields.
Used in Material Development:
2',4'-DIFLUORO-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE is utilized in the development of new materials, leveraging its unique chemical properties to create innovative materials with specific characteristics for various applications.
Used as a Reagent in Chemical Reactions:
2',4'-DIFLUORO-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE also functions as a reagent in various chemical reactions, facilitating specific transformations and processes in the synthesis of target molecules. Its presence can enhance the efficiency and selectivity of these reactions, making it an essential tool in chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 898780-57-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,8 and 0 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 898780-57:
(8*8)+(7*9)+(6*8)+(5*7)+(4*8)+(3*0)+(2*5)+(1*7)=259
259 % 10 = 9
So 898780-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H14F2OS/c1-20-16-5-3-2-4-11(16)6-9-15(19)13-8-7-12(17)10-14(13)18/h2-5,7-8,10H,6,9H2,1H3
