898780-57-9 Usage
General Description
2',4'-DIFLUORO-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE is a chemical compound with the molecular formula C16H12F2OS. It is a propiophenone derivative with two fluorine atoms and a thiomethylphenyl group attached to the carbon chain. 2',4'-DIFLUORO-3-(2-THIOMETHYLPHENYL)PROPIOPHENONE is often used in organic synthesis and pharmaceutical research as a building block for the preparation of various pharmaceutical drugs and organic compounds. It is also used in the development of new materials and as a reagent in chemical reactions. The presence of fluorine and thiophenyl groups in the molecule gives this compound unique properties and reactivity, making it a valuable and versatile chemical in various fields of study and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 898780-57-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,8 and 0 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 898780-57:
(8*8)+(7*9)+(6*8)+(5*7)+(4*8)+(3*0)+(2*5)+(1*7)=259
259 % 10 = 9
So 898780-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H14F2OS/c1-20-16-5-3-2-4-11(16)6-9-15(19)13-8-7-12(17)10-14(13)18/h2-5,7-8,10H,6,9H2,1H3
