898780-64-8 Usage
Uses
Used in Organic Synthesis:
2',4'-DIMETHYL-3-(3,5-DIMETHYLPHENYL)PROPIOPHENONE is used as a key intermediate in the synthesis of various organic compounds, particularly those with aromatic structures. Its unique molecular structure allows for versatile chemical reactions, making it a valuable component in the creation of new molecules with potential applications in various industries.
Used in Chemical Research:
In the field of chemical research, 2',4'-DIMETHYL-3-(3,5-DIMETHYLPHENYL)PROPIOPHENONE serves as a subject of study for understanding the properties and behavior of propiophenone derivatives. Researchers utilize 2',4'-DIMETHYL-3-(3,5-DIMETHYLPHENYL)PROPIOPHENONE to explore its reactivity, stability, and potential interactions with other chemical entities, contributing to the advancement of knowledge in organic chemistry.
Used in Pharmaceutical Industry:
2',4'-DIMETHYL-3-(3,5-DIMETHYLPHENYL)PROPIOPHENONE is used as a building block in the development of pharmaceutical compounds. Its unique structure and functional groups make it a promising candidate for the synthesis of new drugs with potential therapeutic applications. Researchers in the pharmaceutical industry leverage the compound's properties to design and create novel molecules with targeted effects on specific biological pathways.
Used in Material Science:
In the field of material science, 2',4'-DIMETHYL-3-(3,5-DIMETHYLPHENYL)PROPIOPHENONE is utilized in the development of new materials with specific properties. Its aromatic and ketone functional groups contribute to the creation of materials with unique characteristics, such as enhanced stability, improved conductivity, or tailored optical properties, making it a valuable component in the advancement of material science.
Check Digit Verification of cas no
The CAS Registry Mumber 898780-64-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,8 and 0 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 898780-64:
(8*8)+(7*9)+(6*8)+(5*7)+(4*8)+(3*0)+(2*6)+(1*4)=258
258 % 10 = 8
So 898780-64-8 is a valid CAS Registry Number.
InChI:InChI=1/C19H22O/c1-13-5-7-18(16(4)10-13)19(20)8-6-17-11-14(2)9-15(3)12-17/h5,7,9-12H,6,8H2,1-4H3
