898786-90-8 Usage
General Description
2',5'-DIFLUORO-5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)VALEROPHENONE is a chemical compound with the molecular formula C17H21F2O3. It is a valerophenone derivative with two fluorine atoms at positions 2' and 5' of the phenyl ring, and a 5,5-dimethyl-1,3-dioxan-2-yl group attached to the carbon at position 5 of the phenyl ring. 2',5'-DIFLUORO-5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)VALEROPHENONE has potential applications in pharmaceutical and agrochemical industries due to its unique molecular structure and functional groups, which can be used as building blocks for the synthesis of various biologically active molecules. Additionally, its fluorine-containing substituents can impart desirable properties such as increased chemical stability and improved pharmacokinetic profiles. Further research and development are needed to explore the full potential of 2',5'-DIFLUORO-5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)VALEROPHENONE in various fields of chemistry and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 898786-90-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,8 and 6 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 898786-90:
(8*8)+(7*9)+(6*8)+(5*7)+(4*8)+(3*6)+(2*9)+(1*0)=278
278 % 10 = 8
So 898786-90-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H22F2O3/c1-17(2)10-21-16(22-11-17)6-4-3-5-15(20)13-9-12(18)7-8-14(13)19/h7-9,16H,3-6,10-11H2,1-2H3
