898786-95-3 Usage
### Main Properties
1. Molecular Formula: C16H20F2O3
2. Chemical Class: Valerophenone derivative
3. Fluorine Position: Two fluorine atoms at the 2' and 6' positions
4. Functional Group: 1,3-dioxane ring at the 5 position
### Specific Content
1. Usage in Organic Synthesis and Pharmaceutical Research:
Explanation: It serves as a building block for the synthesis of various biologically active compounds.
2. Application in Perfumes and Flavorings:
Explanation: Due to its aromatic nature, it's utilized in the production of perfumes and flavorings.
3. Potential Pharmacological Properties:
Explanation: Research indicates it may possess pharmacological properties, making it an intriguing candidate in drug discovery and development.
Diverse Applications
Explanation: 2',6'-DIFLUORO-5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)VALEROPHENONE has versatile uses across various industries, particularly in organic chemistry and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 898786-95-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,8 and 6 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 898786-95:
(8*8)+(7*9)+(6*8)+(5*7)+(4*8)+(3*6)+(2*9)+(1*5)=283
283 % 10 = 3
So 898786-95-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H22F2O3/c1-17(2)10-21-15(22-11-17)9-4-3-8-14(20)16-12(18)6-5-7-13(16)19/h5-7,15H,3-4,8-11H2,1-2H3
