898790-08-4 Usage
Uses
Used in Pharmaceutical Industry:
2',4'-DIFLUORO-3-(2-METHYLPHENYL)PROPIOPHENONE is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs with improved properties. Its unique chemical structure allows for the creation of molecules with enhanced bioactivity, selectivity, and pharmacokinetic profiles.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 2',4'-DIFLUORO-3-(2-METHYLPHENYL)PROPIOPHENONE serves as a valuable building block for the design and synthesis of novel bioactive molecules. Its fluorinated moieties can significantly influence the physicochemical and biological properties of the resulting compounds, leading to the discovery of new therapeutic agents.
Used in Organic Synthesis:
2',4'-DIFLUORO-3-(2-METHYLPHENYL)PROPIOPHENONE is utilized as a versatile starting material in organic synthesis for the preparation of a wide range of organic compounds. Its reactivity and functional group compatibility make it suitable for various synthetic routes, including cross-coupling reactions, oxidation, and reduction processes, ultimately expanding the scope of accessible chemical entities.
Used in Drug Discovery:
2',4'-DIFLUORO-3-(2-METHYLPHENYL)PROPIOPHENONE plays a crucial role in drug discovery as a structural component of potential lead compounds. Its unique features can be exploited to design molecules with optimized binding affinities, selectivity, and pharmacological properties, accelerating the identification of new drug candidates for various therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 898790-08-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,9 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 898790-08:
(8*8)+(7*9)+(6*8)+(5*7)+(4*9)+(3*0)+(2*0)+(1*8)=254
254 % 10 = 4
So 898790-08-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H14F2O/c1-11-4-2-3-5-12(11)6-9-16(19)14-8-7-13(17)10-15(14)18/h2-5,7-8,10H,6,9H2,1H3
