898790-08-4 Usage
General Description
2',4'-DIFLUORO-3-(2-METHYLPHENYL)PROPIOPHENONE is a chemical compound with the molecular formula C14H11F2O. It is a propiophenone derivative with two fluorine atoms at positions 2 and 4, and a 2-methylphenyl group at position 3. 2',4'-DIFLUORO-3-(2-METHYLPHENYL)PROPIOPHENONE is commonly used as an intermediate in the synthesis of pharmaceuticals and other organic compounds. It has potential applications in the field of medicinal chemistry and drug discovery due to its unique chemical structure and properties. Additionally, its fluorinated moieties make it a valuable building block for the development of novel bioactive molecules. Overall, 2',4'-DIFLUORO-3-(2-METHYLPHENYL)PROPIOPHENONE is a versatile chemical compound with potential uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 898790-08-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,8,7,9 and 0 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 898790-08:
(8*8)+(7*9)+(6*8)+(5*7)+(4*9)+(3*0)+(2*0)+(1*8)=254
254 % 10 = 4
So 898790-08-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H14F2O/c1-11-4-2-3-5-12(11)6-9-16(19)14-8-7-13(17)10-15(14)18/h2-5,7-8,10H,6,9H2,1H3
