89929-85-1 Usage
Uses
Used in Pharmaceutical Industry:
3-[3-(BROMOMETHYL)PHENYL]THIOPHENE is used as a building block for the synthesis of pharmaceutical compounds due to its unique electronic and structural properties. The bromomethyl group allows for further chemical modification, enabling the development of new drugs with improved efficacy and selectivity.
Used in Agrochemical Industry:
3-[3-(BROMOMETHYL)PHENYL]THIOPHENE is used as a starting material for the synthesis of agrochemicals, such as pesticides and herbicides. Its versatile chemical structure allows for the creation of new compounds with enhanced activity and selectivity against target pests and weeds.
Used in Materials Science:
3-[3-(BROMOMETHYL)PHENYL]THIOPHENE is used as a component in the development of advanced materials, such as polymers, coatings, and sensors. Its unique electronic properties can be utilized to create materials with specific characteristics, such as improved conductivity, stability, or sensitivity to environmental changes.
Check Digit Verification of cas no
The CAS Registry Mumber 89929-85-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,9,2 and 9 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 89929-85:
(7*8)+(6*9)+(5*9)+(4*2)+(3*9)+(2*8)+(1*5)=211
211 % 10 = 1
So 89929-85-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H9BrS/c12-7-9-2-1-3-10(6-9)11-4-5-13-8-11/h1-6,8H,7H2
89929-85-1Relevant academic research and scientific papers
Heterocyclic substituted benzyl alcohol, insecticidal ester derivatives, and intermediates
-
, (2008/06/13)
Disclosed and exemplified are insecticidal and acaricidal optionally substituted furylbenzyl, thienylbenzyl, pyrazinylbenzyl, or pyridinzylbenzyl esters of the pyrethroid acids, novel pyrethroid alcohols and other intermediates, and compositions, a method of use and a process for preparation of the esters.
