899438-92-7 Usage
Uses
Used in Medicinal Chemistry and Drug Discovery:
6-Isoquinolinyl-boronic acid is utilized as a ligand in metal-catalyzed cross-coupling reactions, which are crucial for the synthesis of complex organic molecules with potential pharmaceutical applications. Its ability to facilitate the formation of new carbon-carbon and carbon-heteroatom bonds makes it a valuable component in the creation of diverse bioactive compounds.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 6-Isoquinolinyl-boronic acid serves as a key intermediate in the synthesis of various drug candidates. Its unique structural features allow for the development of molecules with specific biological activities, contributing to the discovery of new therapeutic agents.
Used in Agrochemical Development:
6-Isoquinolinyl-boronic acid is also employed in the agrochemical sector, where it is used as a precursor in the synthesis of novel compounds with pesticidal or herbicidal properties. Its versatility in organic synthesis aids in the creation of new agrochemicals that can address evolving challenges in agriculture.
Used in Electronic and Optoelectronic Materials:
6-Isoquinolinyl-boronic acid has been investigated for its potential in the design and synthesis of new materials for electronic and optoelectronic devices. Its electronic properties and ability to form stable complexes make it a promising candidate for applications in semiconductors, light-emitting diodes, and photovoltaic cells.
Check Digit Verification of cas no
The CAS Registry Mumber 899438-92-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,9,9,4,3 and 8 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 899438-92:
(8*8)+(7*9)+(6*9)+(5*4)+(4*3)+(3*8)+(2*9)+(1*2)=257
257 % 10 = 7
So 899438-92-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H8BNO2/c12-10(13)9-2-1-8-6-11-4-3-7(8)5-9/h1-6,12-13H
