89977-22-0 Usage
Description
2-Hydroxy-4,6-diMethyl-5-nitronicotinic acid is a chemical compound that belongs to the family of nicotinic acids. It is a derivative of nicotinic acid and is characterized by the presence of a hydroxyl group, two methyl groups, and a nitro group in its chemical structure.
Used in Pharmaceutical Industry:
2-Hydroxy-4,6-diMethyl-5-nitronicotinic acid is used as a building block for the synthesis of various pharmaceuticals and agrochemicals. Its unique chemical structure allows it to be a versatile component in the development of new drugs and agricultural chemicals.
Used in Antimicrobial Applications:
2-Hydroxy-4,6-diMethyl-5-nitronicotinic acid is used as an antimicrobial agent for its potential biological activities. It has been studied for its ability to inhibit the growth of certain microorganisms, making it a promising candidate for use in antimicrobial applications.
Used in Antifungal Applications:
2-Hydroxy-4,6-diMethyl-5-nitronicotinic acid is used as an antifungal agent for its potential biological activities. It has been investigated for its ability to inhibit the growth of certain fungi, making it a promising candidate for use in antifungal applications.
Used in Material Science:
2-Hydroxy-4,6-diMethyl-5-nitronicotinic acid is used in the development of new materials due to its unique chemical properties. Its potential use in material science could lead to the creation of innovative materials with various applications.
Used as a Catalyst in Organic Reactions:
2-Hydroxy-4,6-diMethyl-5-nitronicotinic acid has been investigated for its potential use as a catalyst in organic reactions. Its unique chemical structure allows it to facilitate certain chemical reactions, making it a valuable tool in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 89977-22-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,9,7 and 7 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 89977-22:
(7*8)+(6*9)+(5*9)+(4*7)+(3*7)+(2*2)+(1*2)=210
210 % 10 = 0
So 89977-22-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2O5/c1-3-5(8(12)13)7(11)9-4(2)6(3)10(14)15/h1-2H3,(H,9,11)(H,12,13)