89978-48-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-1-(6-methyl-pyridin-3-yl)-ethanone hydrobromide is used as an intermediate in the synthesis of pharmaceuticals for its versatility in reacting with various organic compounds, contributing to the development of new drugs and treatments.
Used in Agrochemical Industry:
2-Bromo-1-(6-methyl-pyridin-3-yl)-ethanone hydrobromide is used as an intermediate in the synthesis of agrochemicals, playing a role in the development of new pesticides and other agricultural chemicals.
Used in Medicinal Chemistry Research:
2-Bromo-1-(6-methyl-pyridin-3-yl)-ethanone hydrobromide is used as a building block in medicinal chemistry research for its potential biological activities and pharmacological properties, aiding in the discovery and development of innovative treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 89978-48-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,9,7 and 8 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 89978-48:
(7*8)+(6*9)+(5*9)+(4*7)+(3*8)+(2*4)+(1*8)=223
223 % 10 = 3
So 89978-48-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BrNO.BrH/c1-6-2-3-7(5-10-6)8(11)4-9;/h2-3,5H,4H2,1H3;1H
89978-48-3Relevant academic research and scientific papers
Pyrimidinone Derivatives as Antimalarial Agents
-
Paragraph 0902; 0903; 0904, (2015/07/15)
The invention relates to novel pyrimidinone-based heterocyclic compounds which are parasite growth inhibitors, having the general formula (I) in which Y is a morpholine chosen from three bridged morpholines, L is a bond or a linker, n=0 or 1 and R2 is a methyl group when n=0 and a hydrogen atom when n=1. Process for the preparation thereof and therapeutic use thereof.
PYRIMIDINONE DERIVATIVES AS ANTIMALARIAL AGENTS
-
Page/Page column 68; 100; 101, (2014/01/09)
The invention relates to novel pyrimidinone-based heterocyclic compounds which are parasite growth inhibitors, having the general formula (I) in which Y is a morpholine chosen from three bridged morpholines, L is a bond or a linker, n = 0 or 1 and R2 is a methyl group when n = 0 and a hydrogen atom when n = 1. Process for the preparation thereof and therapeutic use thereof.
