90009-28-2 Usage
General Description
1-(2-bromoprop-2-enylamino)but-3-en-2-ol is a chemical compound with a complex structure containing a bromine atom and multiple unsaturated carbon-carbon bonds. It is a derivative of butenol, and contains an amino group and a bromo group attached to a butenol backbone. The compound has potential use in organic synthesis and pharmaceuticals, and its precise properties and potential applications would require further investigation and research. Given its structural complexity and the presence of multiple functional groups, 1-(2-bromoprop-2-enylamino)but-3-en-2-ol is likely to have a range of interesting and potentially valuable chemical and biological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 90009-28-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,0,0 and 9 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 90009-28:
(7*9)+(6*0)+(5*0)+(4*0)+(3*9)+(2*2)+(1*8)=102
102 % 10 = 2
So 90009-28-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H12BrNO/c1-3-7(10)5-9-4-6(2)8/h3,7,9-10H,1-2,4-5H2