90065-35-3 Usage
Molecular structure
A complex structure containing a pyrazinoisoquinoline framework with a methyl group and a phenyl group attached to specific carbon atoms.
Classification
Belongs to the class of heterocyclic compounds.
Potential applications
Has potential applications in medicinal chemistry and pharmaceutical research.
Biological activities
May have biological activities and therapeutic properties that can be further explored for potential drug development.
Determination of properties and uses
The specific properties and uses of this chemical compound may be determined through thorough experimental and analytical studies.
Molecular weight
Approximately 315.42 g/mol (calculated from the chemical formula).
Appearance
The appearance of the compound is not provided in the material, but it is likely a solid due to its molecular weight and complexity.
Solubility
The solubility of the compound is not provided in the material, but it may be soluble in organic solvents such as ethanol, methanol, or dimethyl sulfoxide (DMSO) due to its nonpolar nature.
Stability
The stability of the compound is not provided in the material, but it may be sensitive to light, heat, or moisture, which are common factors affecting the stability of heterocyclic compounds.
Reactivity
The reactivity of the compound is not provided in the material, but it may undergo reactions such as oxidation, reduction, or substitution reactions due to the presence of various functional groups in its structure.
Synthesis
The synthesis method for 1,3,4,6,7,11b-hexahydro-2-methyl-7-phenyl-2H-pyrazino(2,1-a)isoquinoline is not provided in the material, but it may involve the formation of the pyrazinoisoquinoline framework followed by the introduction of the methyl and phenyl groups at specific carbon atoms.
Purification
The purification method for 1,3,4,6,7,11b-hexahydro-2-methyl-7-phenyl-2H-pyrazino(2,1-a)isoquinoline is not provided in the material, but common purification techniques for organic compounds include column chromatography, recrystallization, or distillation.
Analysis
The analysis of the compound may involve techniques such as nuclear magnetic resonance (NMR) spectroscopy, mass spectrometry (MS), and infrared (IR) spectroscopy to confirm its structure and purity.
Safety precautions
The safety precautions for handling 1,3,4,6,7,11b-hexahydro-2-methyl-7-phenyl-2H-pyrazino(2,1-a)isoquinoline are not provided in the material, but it is essential to follow standard laboratory safety protocols, such as wearing gloves, goggles, and a lab coat, and working in a well-ventilated area or fume hood.
Check Digit Verification of cas no
The CAS Registry Mumber 90065-35-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,0,6 and 5 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 90065-35:
(7*9)+(6*0)+(5*0)+(4*6)+(3*5)+(2*3)+(1*5)=113
113 % 10 = 3
So 90065-35-3 is a valid CAS Registry Number.
InChI:InChI=1/C19H22N2/c1-20-11-12-21-13-18(15-7-3-2-4-8-15)16-9-5-6-10-17(16)19(21)14-20/h2-10,18-19H,11-14H2,1H3/t18-,19+/m0/s1
90065-35-3Relevant academic research and scientific papers
cis-1,3,4,6,7,11b-Hexahydro-2-methyl-7-phenyl-2H-pyrazino[2,1-a] isoquinoline: a new atypical antidepressant.
Griffith,Gentile,Robichaud,Frankenheim
, p. 995 - 1003 (2007/10/02)
Molecular modelling studies suggested the synthesis of cis-1,3,4,6,7, 11b-hexahydro-2-methyl-7-phenyl-2H-pyrazino[2,1-a]isoquinoline (7a) as a rigid analogue of the atypical antidepressant mianserin. Acylation of 2,2-diphenylethylamine with chloroacetyl c
