90084-48-3 Usage
Uses
Used in Organic Synthesis:
1,4-Piperazinedicarboxaldehyde,2,3-dihydroxy-(7CI,9CI) is used as a building block in organic synthesis for the creation of various organic compounds. Its unique structure allows for the formation of diverse chemical entities, contributing to the development of new materials and compounds with specific properties.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 1,4-Piperazinedicarboxaldehyde,2,3-dihydroxy-(7CI,9CI) is utilized as a potential intermediate in the production of pharmaceuticals. Its presence in the synthesis process can lead to the development of new drugs with improved efficacy and reduced side effects.
Used in Biological Activity Studies:
1,4-Piperazinedicarboxaldehyde,2,3-dihydroxy-(7CI,9CI) is being investigated for its potential biological activities. Its unique chemical structure may confer pharmacological properties that could be harnessed for therapeutic applications, making it a promising candidate for further research in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 90084-48-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,0,8 and 4 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 90084-48:
(7*9)+(6*0)+(5*0)+(4*8)+(3*4)+(2*4)+(1*8)=123
123 % 10 = 3
So 90084-48-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N2O4/c9-3-7-1-2-8(4-10)6(12)5(7)11/h3-6,11-12H,1-2H2
