90109-14-1 Usage
Molecular structure
The compound has a complex molecular structure, featuring a benzocycloheptene ring with two hydroxyl groups attached at the 1 and 2 positions, and a N-(2-methylethyl)amino group attached at the 6 position.
Benzocycloheptene ring
The core structure of the compound is a benzocycloheptene ring, which is a seven-membered ring fused to a benzene ring.
N-(2-methylethyl)amino group
The compound contains an N-(2-methylethyl)amino group (also known as an isopropylamine group) attached at the 6 position of the benzocycloheptene ring, which adds steric bulk and potential for hydrogen bonding.
Potential applications
Due to its unique structure and properties, 1,2-dihydroxy-6-(N-(2-methylethyl)amino)-6,7,8,9-tetrahydrobenzocycloheptene has potential applications in the pharmaceutical industry and drug development.
Biological activity
The compound may exhibit biological activity, making it a candidate for further research and potential use in medical studies.
Research and development
As a complex chemical compound, 1,2-dihydroxy-6-(N-(2-methylethyl)amino)-6,7,8,9-tetrahydrobenzocycloheptene may be of interest to researchers in the fields of organic chemistry, medicinal chemistry, and pharmacology.
Solubility
The presence of hydroxyl and amine groups in the molecule may affect its solubility in various solvents, with potential for increased solubility in polar solvents like water or alcohols.
Stability
The compound's stability may be influenced by factors such as temperature, pH, and exposure to light or air, which could be important considerations for its storage and handling.
Synthesis
The synthesis of 1,2-dihydroxy-6-(N-(2-methylethyl)amino)-6,7,8,9-tetrahydrobenzocycloheptene may involve multiple steps and require specific reaction conditions, making it a target for optimization in chemical synthesis research.
Check Digit Verification of cas no
The CAS Registry Mumber 90109-14-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,1,0 and 9 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 90109-14:
(7*9)+(6*0)+(5*1)+(4*0)+(3*9)+(2*1)+(1*4)=101
101 % 10 = 1
So 90109-14-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H23NO2/c1-2-8-15-11-4-3-5-12-10(9-11)6-7-13(16)14(12)17/h7,10-11,15-17H,2-6,8-9H2,1H3