90112-08-6 Usage
Structural Features
Pyrimidine derivative with an amino group at the 2nd position and a sulfur atom at the 4th position.
Physical State
White to off-white solid
Solubility
Soluble in water
Applications
Intermediate in the synthesis of various drugs in the pharmaceutical industry
Potential biological activities:
Antitumor properties
Antimicrobial properties
Used in research and laboratory applications for its versatile properties and potential applications
Overall Significance
Crucial compound in chemistry and pharmaceuticals due to its diverse range of potential applications and biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 90112-08-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,1,1 and 2 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 90112-08:
(7*9)+(6*0)+(5*1)+(4*1)+(3*2)+(2*0)+(1*8)=86
86 % 10 = 6
So 90112-08-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H14N4S/c1-2-3-4-10-6-5-7(13)12-8(9)11-6/h5H,2-4H2,1H3,(H4,9,10,11,12,13)
