90151-50-1 Usage
Uses
Used in Organic Synthesis:
3-BROMOBENZYLGUANIDINIUM SULFATE is used as a reagent for its unique reactivity and selectivity in various organic synthesis processes, facilitating the formation of desired products with improved efficiency.
Used in Pharmaceutical Industry:
3-BROMOBENZYLGUANIDINIUM SULFATE is used as a catalyst in pharmaceutical reactions to enhance the rate of chemical transformations, leading to the production of pharmaceutical compounds with greater yield and purity.
Used in Materials Science:
3-BROMOBENZYLGUANIDINIUM SULFATE is used as a component in the development of new materials, leveraging its unique chemical properties to create materials with specific characteristics for various applications.
Used in Catalysis:
3-BROMOBENZYLGUANIDINIUM SULFATE is used as a catalyst to promote specific chemical reactions, improving the efficiency and selectivity of processes in various industrial applications.
Used as an Intermediate in Synthesis:
3-BROMOBENZYLGUANIDINIUM SULFATE is used as an intermediate in the synthesis of other biologically active compounds, contributing to the development of new pharmaceuticals and chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 90151-50-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,1,5 and 1 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 90151-50:
(7*9)+(6*0)+(5*1)+(4*5)+(3*1)+(2*5)+(1*0)=101
101 % 10 = 1
So 90151-50-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H10BrN3.H2O4S/c9-7-3-1-2-6(4-7)5-12-8(10)11;1-5(2,3)4/h1-4H,5H2,(H4,10,11,12);(H2,1,2,3,4)
