901586-62-7 Usage
General Description
4-CHLORO-6-ETHYL-2-(1-PYRROLIDINYL)PYRIMIDINE is a chemical compound with the molecular formula C11H15ClN4. It is a pyrimidine derivative with a chlorine atom at the 4th position, an ethyl group at the 6th position, and a pyrrolidinyl group at the 2nd position. 4-CHLORO-6-ETHYL-2-(1-PYRROLIDINYL)PYRIMIDINE is commonly used in pharmaceutical research as a potential drug candidate for various medical applications. Its unique chemical structure and properties make it a valuable building block in the development of new drugs and therapeutic agents. Additionally, its incorporation of a pyrrolidinyl group suggests potential interactions with cholinergic receptors, making it a potential candidate for pharmacological studies related to the central nervous system.
Check Digit Verification of cas no
The CAS Registry Mumber 901586-62-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,1,5,8 and 6 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 901586-62:
(8*9)+(7*0)+(6*1)+(5*5)+(4*8)+(3*6)+(2*6)+(1*2)=167
167 % 10 = 7
So 901586-62-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H14ClN3/c1-2-8-7-9(11)13-10(12-8)14-5-3-4-6-14/h7H,2-6H2,1H3