90221-15-1 Usage
Uses
Used in Pharmaceutical Industry:
5-cyclopentyl-1,3,4-oxadiazol-2-amine is used as a drug development candidate for its biological activities. Its unique structure and functional groups contribute to its potential as a therapeutic agent, making it a valuable compound for the creation of new medications.
Used in Agricultural Industry:
In the agricultural sector, 5-cyclopentyl-1,3,4-oxadiazol-2-amine is utilized for the formulation of pesticides and fungicides. Its agrochemical properties allow it to be an effective component in controlling pests and diseases that affect crops, thereby contributing to increased agricultural productivity and crop protection.
Check Digit Verification of cas no
The CAS Registry Mumber 90221-15-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,2,2 and 1 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 90221-15:
(7*9)+(6*0)+(5*2)+(4*2)+(3*1)+(2*1)+(1*5)=91
91 % 10 = 1
So 90221-15-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N3O/c8-7-10-9-6(11-7)5-3-1-2-4-5/h5H,1-4H2,(H2,8,10)
