90226-98-5 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
(2,2-DIMETHYL-TETRAHYDRO-PYRAN-4-YL)-METHYL-AMINE is used as a building block for the synthesis of various pharmaceutical and agrochemical compounds. Its unique structure and reactivity make it a valuable component in the development of new and innovative products within these industries.
Used in Organic Synthesis:
As a reagent, (2,2-DIMETHYL-TETRAHYDRO-PYRAN-4-YL)-METHYL-AMINE is used in organic synthesis to create a wide range of chemical compounds. Its versatility in forming different types of bonds and its compatibility with various reaction conditions make it a popular choice among chemists.
Used in Coordination Chemistry:
(2,2-DIMETHYL-TETRAHYDRO-PYRAN-4-YL)-METHYL-AMINE can be used as a ligand in coordination chemistry. Its ability to form stable complexes with metal ions allows it to be employed in the development of catalysts and other coordination compounds.
Used in Drug Development:
Due to its unique structure and reactivity, (2,2-DIMETHYL-TETRAHYDRO-PYRAN-4-YL)-METHYL-AMINE may have potential applications in the development of new drugs. Its properties could contribute to the creation of novel therapeutic agents with improved efficacy and selectivity.
Used in Material Science:
(2,2-DIMETHYL-TETRAHYDRO-PYRAN-4-YL)-METHYL-AMINE may also have potential applications in the development of new materials. Its unique structure and reactivity could be harnessed to create innovative materials with specific properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 90226-98-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,2,2 and 6 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 90226-98:
(7*9)+(6*0)+(5*2)+(4*2)+(3*6)+(2*9)+(1*8)=125
125 % 10 = 5
So 90226-98-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H17NO/c1-8(2)6-7(9-3)4-5-10-8/h7,9H,4-6H2,1-3H3
