90272-96-1 Usage
Uses
Used in Pharmaceutical Research and Development:
2-(5-CHLOROMETHYL-[1,2,4]OXADIAZOL-3-YL)-PHENOL is used as a chemical intermediate for the development of new pharmaceuticals due to its antimicrobial and antioxidant properties. These properties make it a valuable component in the creation of drugs that can combat various diseases and conditions.
Used in Agrochemicals Synthesis:
In the agrochemical industry, 2-(5-CHLOROMETHYL-[1,2,4]OXADIAZOL-3-YL)-PHENOL is used as a key building block for the synthesis of new agrochemicals. Its antimicrobial properties can be leveraged to develop pesticides and other agricultural products that protect crops from diseases and pests, thereby enhancing crop yields and quality.
Used in Antioxidant Formulations:
2-(5-CHLOROMETHYL-[1,2,4]OXADIAZOL-3-YL)-PHENOL is used as an antioxidant in various formulations, such as in the food and cosmetic industries. Its ability to neutralize free radicals and prevent oxidative damage makes it a valuable ingredient in products that require preservation and stability.
Used in Material Science:
The unique structure of 2-(5-CHLOROMETHYL-[1,2,4]OXADIAZOL-3-YL)-PHENOL also makes it a candidate for use in material science, where it can be employed in the development of new materials with specific properties, such as thermal stability, flame retardancy, or chemical resistance.
Overall, the diverse applications of 2-(5-CHLOROMETHYL-[1,2,4]OXADIAZOL-3-YL)-PHENOL across different industries highlight its potential as a versatile chemical compound with significant implications for research, development, and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 90272-96-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,2,7 and 2 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 90272-96:
(7*9)+(6*0)+(5*2)+(4*7)+(3*2)+(2*9)+(1*6)=131
131 % 10 = 1
So 90272-96-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H7ClN2O2/c10-5-8-11-9(12-14-8)6-3-1-2-4-7(6)13/h1-4,13H,5H2
