902836-26-4 Usage
Uses
Given the provided materials, specific applications for [3-(3-Fluoro-benzyloxy)-phenyl]-acetic acid are not explicitly mentioned. However, based on the general properties attributed to similar compounds, potential uses in various industries could include:
Used in Pharmaceutical Industry:
[3-(3-Fluoro-benzyloxy)-phenyl]-acetic acid could be utilized as a pharmaceutical intermediate for the development of drugs targeting specific biochemical pathways due to its fluorinated and benzyloxy structural features, which may enhance its binding affinity and selectivity.
Used in Chemical Research:
In the field of chemical research, [3-(3-Fluoro-benzyloxy)-phenyl]-acetic acid might serve as a subject for studying the effects of fluorination and benzyl protection on the reactivity and stability of organic compounds, potentially leading to the discovery of new reaction mechanisms or synthetic strategies.
Used in Material Science:
[3-(3-FLUORO-BENZYLOXY)-PHENYL]-ACETIC ACID could also be explored in material science for its potential to influence the properties of polymers or other materials, given the presence of the fluorine atom and the benzyloxy group, which might impart unique characteristics to the resulting materials.
Check Digit Verification of cas no
The CAS Registry Mumber 902836-26-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,2,8,3 and 6 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 902836-26:
(8*9)+(7*0)+(6*2)+(5*8)+(4*3)+(3*6)+(2*2)+(1*6)=164
164 % 10 = 4
So 902836-26-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H13FO3/c16-13-5-1-4-12(7-13)10-19-14-6-2-3-11(8-14)9-15(17)18/h1-8H,9-10H2,(H,17,18)
902836-26-4Relevant academic research and scientific papers
Synthesis and aldose reductase inhibitory activities of novel O-substituted hydroxyphenylacetic acid derivatives
Rakowitz, Dietmar,Angerer, Helga,Matuszczak, Barbara
, p. 547 - 558 (2007/10/03)
In continuation of our work aimed towards the preparation of novel aldose reductase inhibitors, several O-substituted hydroxyphenylacetic acid derivatives were investigated. The highest inhibitory activity was found for compounds 7b and 7c bearing a cyclo
