902836-38-8 Usage
Uses
Used in Pharmaceutical Industry:
4-[4-(4-Chlorophenyl)-1H-pyrazol-1-yl]piperidine is used as a key intermediate in the synthesis of various drugs and bioactive molecules. Its unique structural features contribute to the development of new pharmaceutical agents, enhancing the discovery of novel therapeutics.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4-[4-(4-Chlorophenyl)-1H-pyrazol-1-yl]piperidine is utilized as a structural component for designing and optimizing drug candidates. Its presence in molecular frameworks can influence pharmacokinetic and pharmacodynamic properties, thereby improving the efficacy and safety profiles of new drugs.
Used in Agrochemical Industry:
4-[4-(4-Chlorophenyl)-1H-pyrazol-1-yl]piperidine is employed as a chemical building block in the agrochemical industry, where it may be incorporated into the development of new pesticides, herbicides, or other agrochemical products. Its chlorophenyl group could provide specific biological activities beneficial in this context.
Used in Material Science:
In material science, 4-[4-(4-Chlorophenyl)-1H-pyrazol-1-yl]piperidine may be used to develop new materials with unique properties. Its incorporation into polymers or other materials could lead to advancements in areas such as electronics, coatings, or specialty chemicals, where novel materials with specific characteristics are constantly sought after.
Check Digit Verification of cas no
The CAS Registry Mumber 902836-38-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,2,8,3 and 6 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 902836-38:
(8*9)+(7*0)+(6*2)+(5*8)+(4*3)+(3*6)+(2*3)+(1*8)=168
168 % 10 = 8
So 902836-38-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H16ClN3/c15-13-3-1-11(2-4-13)12-9-17-18(10-12)14-5-7-16-8-6-14/h1-4,9-10,14,16H,5-8H2
