902836-42-4 Usage
Uses
Given the lack of detailed information on the applications of 4-[4-(2-Chlorophenyl)-1H-pyrazol-1-yl]piperidine, it is challenging to list specific uses without further research and development. However, based on the general properties of pyrazoles and piperidines, potential applications could include:
Used in Pharmaceutical Industry:
4-[4-(2-Chlorophenyl)-1H-pyrazol-1-yl]piperidine could be used as a pharmaceutical intermediate for the development of new drugs, given the broad range of biological activities exhibited by compounds within the pyrazole and piperidine classes. Its specific structure, including the 2-chlorophenyl group, might offer unique opportunities for medicinal chemistry, potentially leading to the creation of novel therapeutic agents.
Used in Chemical Research:
As a member of the pyrazole and piperidine classes, 4-[4-(2-Chlorophenyl)-1H-pyrazol-1-yl]piperidine might serve as a subject for chemical research to explore its reactivity, stability, and potential to form new compounds or complexes. Understanding its behavior could contribute to the advancement of organic chemistry and the discovery of new materials or processes.
Check Digit Verification of cas no
The CAS Registry Mumber 902836-42-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,2,8,3 and 6 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 902836-42:
(8*9)+(7*0)+(6*2)+(5*8)+(4*3)+(3*6)+(2*4)+(1*2)=164
164 % 10 = 4
So 902836-42-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H20N2O/c1-8(2)7-10(13)12-5-3-9(11)4-6-12/h8-9H,3-7,11H2,1-2H3
