902837-27-8 Usage
Uses
Used in Pharmaceutical Development:
3-(2-Methoxyphenoxy)piperidine is used as a key intermediate in the synthesis of pharmaceutical drugs, specifically for the treatment of neurological disorders and central nervous system diseases. Its unique structure allows for the development of compounds that can modulate the activity of receptors and enzymes involved in these conditions.
Used in Organic Synthesis:
In the field of organic synthesis, 3-(2-Methoxyphenoxy)piperidine is utilized as a building block for the creation of complex organic molecules. Its presence in the molecular structure facilitates the formation of new chemical entities with potential applications in various industries.
Used in Molecular Biology Research:
3-(2-Methoxyphenoxy)piperidine is employed as a ligand in molecular biology research, where it interacts with specific receptors and enzymes. This interaction aids in understanding the mechanisms of action and potential therapeutic effects of the compound, contributing to the advancement of drug discovery and development.
Used in Drug Discovery:
3-(2-Methoxyphenoxy)piperidine is used as a starting material in drug discovery processes, where its chemical properties are exploited to design and synthesize novel therapeutic agents. Its potential as a ligand for various biological targets makes it a valuable tool in the search for new treatments for a range of diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 902837-27-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,2,8,3 and 7 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 902837-27:
(8*9)+(7*0)+(6*2)+(5*8)+(4*3)+(3*7)+(2*2)+(1*7)=168
168 % 10 = 8
So 902837-27-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H17NO2/c1-14-11-6-2-3-7-12(11)15-10-5-4-8-13-9-10/h2-3,6-7,10,13H,4-5,8-9H2,1H3
