902837-32-5 Usage
Uses
Used in Pharmaceutical Industry:
3-(3-Chlorophenoxy)piperidine is used as a chemical intermediate for the synthesis of a range of drugs and bioactive molecules. Its role in the development of potential therapeutic agents is significant due to its inherent pharmacological properties.
Check Digit Verification of cas no
The CAS Registry Mumber 902837-32-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,2,8,3 and 7 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 902837-32:
(8*9)+(7*0)+(6*2)+(5*8)+(4*3)+(3*7)+(2*3)+(1*2)=165
165 % 10 = 5
So 902837-32-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H14ClNO/c12-9-3-1-4-10(7-9)14-11-5-2-6-13-8-11/h1,3-4,7,11,13H,2,5-6,8H2
