902837-42-7 Usage
Uses
Used in Pharmaceutical Synthesis:
7-Bromo-1H-pyrrolo[3,2-c]pyridine is used as a key intermediate in the synthesis of pharmaceuticals for its ability to be incorporated into complex molecular structures, contributing to the development of new drugs with potential therapeutic effects.
Used in Agrochemical Development:
In the agrochemical industry, 7-Bromo-1H-pyrrolo[3,2-c]pyridine is utilized as a precursor in the creation of compounds that can be applied in pest control and crop protection, enhancing agricultural productivity and crop safety.
Used in Organic Compounds Synthesis:
7-Bromo-1H-pyrrolo[3,2-c]pyridine is employed as a versatile building block in the synthesis of a wide array of organic compounds, allowing for the exploration of novel chemical properties and potential applications in various fields.
Used as a Ligand in Coordination Chemistry:
7-Bromo-1H-pyrrolo[3,2-c]pyridine is used as a ligand in coordination chemistry, where it can form complexes with metal ions, contributing to the study and development of new materials with specific catalytic, electronic, or optical properties.
Used in Catalysis:
As a component in catalytic systems, 7-Bromo-1H-pyrrolo[3,2-c]pyridine can be used to facilitate chemical reactions, improving reaction rates and selectivity in various organic synthesis processes.
Check Digit Verification of cas no
The CAS Registry Mumber 902837-42-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,2,8,3 and 7 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 902837-42:
(8*9)+(7*0)+(6*2)+(5*8)+(4*3)+(3*7)+(2*4)+(1*2)=167
167 % 10 = 7
So 902837-42-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H5BrN2/c8-6-4-9-3-5-1-2-10-7(5)6/h1-4,10H
