902837-53-0 Usage
Uses
Used in Pharmaceutical Synthesis:
2-(Cyclopropylmethoxy)-5-iodopyridine is utilized as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the creation of a wide range of organic compounds, making it a valuable component in drug development.
Used in Agrochemical Production:
In the agrochemical industry, 2-(Cyclopropylmethoxy)-5-iodopyridine serves as a crucial building block for the development of new agrochemicals. Its incorporation into these products can lead to enhanced crop protection and management solutions.
Used in Drug Development:
2-(CYCLOPROPYLMETHOXY)-5-IODOPYRIDINE has demonstrated potential biological activities, positioning it as a candidate for the development of new drug candidates. Its unique properties may contribute to the creation of innovative treatments and therapies in the medical field.
Safety Precautions:
As with any chemical compound, it is essential to follow proper handling and safety procedures when working with 2-(Cyclopropylmethoxy)-5-iodopyridine to ensure the well-being of individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 902837-53-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,0,2,8,3 and 7 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 902837-53:
(8*9)+(7*0)+(6*2)+(5*8)+(4*3)+(3*7)+(2*5)+(1*3)=170
170 % 10 = 0
So 902837-53-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H10INO/c10-8-3-4-9(11-5-8)12-6-7-1-2-7/h3-5,7H,1-2,6H2
