90323-16-3 Usage
Uses
Used in Pharmaceutical Research and Development:
7-AMINO-2-HYDROXY-1,8-NAPHTHYRIDINE-4-CARBOXYLIC ACID is used as a building block in the synthesis of new drug candidates. Its unique structure allows for the development of new chemical entities with desired pharmacological properties, contributing to the advancement of medicine.
Further research and studies are required to fully understand the potential uses and properties of 7-AMINO-2-HYDROXY-1,8-NAPHTHYRIDINE-4-CARBOXYLIC ACID, ensuring its safe and effective application in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 90323-16-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,3,2 and 3 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 90323-16:
(7*9)+(6*0)+(5*3)+(4*2)+(3*3)+(2*1)+(1*6)=103
103 % 10 = 3
So 90323-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H7N3O3/c10-6-2-1-4-5(9(14)15)3-7(13)12-8(4)11-6/h1-3H,(H,14,15)(H3,10,11,12,13)
