90346-64-8 Usage
General Description
3-Chloro-2,6-dimethoxybenzamide is a chemical compound with the molecular formula C9H10ClNO3. It is a derivative of benzamide and contains a chlorine atom as well as two methoxy groups on the benzene ring. 3-CHLORO-2,6-DIMETHOXYBENZAMIDE is often used in organic synthesis and pharmaceutical research, as it can undergo various reactions to form new compounds with different properties. It may also have potential applications in the development of drugs or agrochemicals due to its structural features and reactivity. Additionally, 3-chloro-2,6-dimethoxybenzamide is a solid, white or off-white powder at room temperature and is typically handled and stored in a controlled environment to avoid degradation or contamination.
Check Digit Verification of cas no
The CAS Registry Mumber 90346-64-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,3,4 and 6 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 90346-64:
(7*9)+(6*0)+(5*3)+(4*4)+(3*6)+(2*6)+(1*4)=128
128 % 10 = 8
So 90346-64-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H10ClNO3/c1-13-6-4-3-5(10)8(14-2)7(6)9(11)12/h3-4H,1-2H3,(H2,11,12)
