90370-38-0 Usage
Uses
Used in Pharmaceutical Research:
6-(DIMETHOXYMETHYL)-2-MERCAPTOPYRIMIDIN-4-OL is used as a potential drug candidate for various therapeutic applications in the pharmaceutical industry. Its molecular structure suggests that it may possess biological activities such as antioxidant, anti-inflammatory, or antimicrobial properties, making it a valuable compound for the development of new medications.
Used in Antioxidant Applications:
In the field of health and wellness, 6-(DIMETHOXYMETHYL)-2-MERCAPTOPYRIMIDIN-4-OL is used as an antioxidant agent. Its potential antioxidant properties can help protect cells from damage caused by free radicals and oxidative stress, contributing to the maintenance of overall health.
Used in Anti-Inflammatory Applications:
6-(DIMETHOXYMETHYL)-2-MERCAPTOPYRIMIDIN-4-OL is also used as an anti-inflammatory agent. Its possible anti-inflammatory properties can aid in reducing inflammation and pain, making it a potential candidate for the treatment of various inflammatory conditions.
Used in Antimicrobial Applications:
In the area of infectious diseases, 6-(DIMETHOXYMETHYL)-2-MERCAPTOPYRIMIDIN-4-OL is used as an antimicrobial agent. Its potential antimicrobial properties can help combat various types of infections caused by bacteria, viruses, and other microorganisms.
Further studies and research are necessary to fully understand the potential uses and effects of 6-(DIMETHOXYMETHYL)-2-MERCAPTOPYRIMIDIN-4-OL, as well as to develop novel drug delivery systems and therapeutic strategies that can enhance its efficacy and bioavailability in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 90370-38-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,3,7 and 0 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 90370-38:
(7*9)+(6*0)+(5*3)+(4*7)+(3*0)+(2*3)+(1*8)=120
120 % 10 = 0
So 90370-38-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O3S/c1-11-6(12-2)4-3-5(10)9-7(13)8-4/h3,6H,1-2H3,(H2,8,9,10,13)