90390-33-3 Usage
Uses
Used in Pharmaceutical Industry:
3-Chloro-5-Fluorobenzylamine is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications. The presence of chlorine and fluorine atoms in the molecule can be exploited to create novel chemical entities with improved pharmacological properties, such as increased potency, selectivity, or bioavailability.
Used in Chemical Research:
3-Chloro-5-Fluorobenzylamine is used as a research compound in academic and industrial laboratories. It serves as a valuable tool for studying the effects of substituents on the reactivity and properties of benzylamines. Researchers can use 3-CHLORO-5-FLUOROBENZYLAMINE to investigate various reaction mechanisms, explore new synthetic routes, or develop innovative applications in the field of organic chemistry.
Used in Material Science:
3-Chloro-5-Fluorobenzylamine can be used as a building block in the synthesis of advanced materials with specific properties. Its unique structure and reactivity make it a promising candidate for the development of new polymers, coatings, or other materials with tailored characteristics. These materials could find applications in various industries, such as electronics, automotive, or aerospace, where high-performance materials are in demand.
Used in Agrochemical Industry:
3-Chloro-5-Fluorobenzylamine is used as a starting material or intermediate in the synthesis of agrochemicals, such as pesticides or herbicides. Its distinctive properties can be utilized to create new active ingredients with improved efficacy, selectivity, or environmental compatibility. This can contribute to the development of more sustainable and effective crop protection strategies.
Used in Dye and Pigment Industry:
3-Chloro-5-Fluorobenzylamine can be used as a precursor in the synthesis of dyes and pigments with specific color properties or stability. Its unique structure allows for the creation of novel colorants with improved performance, such as higher color strength, better lightfastness, or enhanced resistance to environmental factors. These dyes and pigments can be used in various applications, including textiles, plastics, or printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 90390-33-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,3,9 and 0 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 90390-33:
(7*9)+(6*0)+(5*3)+(4*9)+(3*0)+(2*3)+(1*3)=123
123 % 10 = 3
So 90390-33-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7ClFN/c8-6-1-5(4-10)2-7(9)3-6/h1-3H,4,10H2
90390-33-3Relevant academic research and scientific papers
Benzylamines: Synthesis and evaluation of antimycobacterial properties
Meindl,Von Angerer,Schonenberger,Ruckdeschel
, p. 1111 - 1118 (2007/10/02)
The synthesis of benzylamines with various N-alkyl chains and substituents in the aromatic system as well as their evaluation on Mycobacterium tuberculosis H 37 Ra are described. The most active compounds in this test, N-methyl-3-chlorobenzylamine (MIC 10.2 μg/mL), N-methyl-3,5-dichlorobenzylamine (93, MIC 10.2 μg/mL), and N-butyl-3,5-difluorobenzylamine (MIC 6.4 μg/mL), also exhibited a marked inhibitory effect on Mycobacterium marinum and Mycobacterium lufu used for the determination of antileprotic properties. The combination of 93 with aminosalicylic acid, streptomycin, or dapsone exert marked supra-additive effects on M. tuberculosis H 37 Ra.
